Metallotetrapyrroles

Thermo Scientific™ Cyancobalamin 96 %, ACROS Organics™

Thermo Scientific™ Cyancobalamin 96 %, ACROS Organics™

CAS: 68-19-9 Summenformel: C63H88CoN14O14P Molekulargewicht (g/mol): 1355.38 MDL-Nummer: MFCD00151092 InChI-Schlüssel: AGVAZMGAQJOSFJ-WZHZPDAFSA-M Synonym: vitamin b12 PubChem CID: 129893524 IUPAC-Name: Kobalt(2+);[(2R,3S,4R,5S)-5-(5,6-Dimethylbenzimidazol-1-yl)-4-Hydroxy-2-(Hydroxymethyl)Oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-Tris(2-Amino-2-Oxoethyl)-7,12,17-Tris(3-Amino-3-Oxopropyl)-3,5,8,8,13,15,18,19-Octamethyl- SMILES: CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2]

Vitamin B12, ≥ 98 % (Trockengewicht), Alfa Aesar™

Vitamin B12, ≥ 98 % (Trockengewicht), Alfa Aesar™

CAS: 68-19-9 Summenformel: C63H89CoN14O14P Molekulargewicht (g/mol): 1356.396 MDL-Nummer: MFCD00151092 InChI-Schlüssel: AGVAZMGAQJOSFJ-WZHZPDAFSA-M Synonym: vitamin b12 PubChem CID: 129893524 IUPAC-Name: Kobalt(2+);[(2R,3S,4R,5S)-5-(5,6-Dimethylbenzimidazol-1-yl)-4-Hydroxy-2-(Hydroxymethyl)Oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,5Z,7S,10Z,12S,13S,15Z,17S,18S,19R)-2,13,18-Tris(2-Amino-2-Oxoethyl)-7,12,17-Tris(3-Amino-3-Oxopropyl)-3,5,8,8,13,15,18,19-Octamethyl- SMILES: CC1=CC2=C(C=C1C)N(C=N2)C3C(C(C(O3)CO)OP(=O)(O)OC(C)CNC(=O)CCC4(C(C5C6(C(C(C(=C(C7=NC(=CC8=NC(=C(C4=N5)C)C(C8(C)C)CCC(=O)N)C(C7(C)CC(=O)N)CCC(=O)N)C)[N-]6)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[C-]#N.[Co+2]

  spinner