1,4-thiazines

Phenothiazin, ≥ 98 %, Thermo Scientific™

Phenothiazin, ≥ 98 %, Thermo Scientific™

CAS: 92-84-2 Summenformel: C12H9NS Molekulargewicht (g/mol): 199.271 MDL-Nummer: MFCD00005015 InChI-Schlüssel: WJFKNYWRSNBZNX-UHFFFAOYSA-N Synonym: agrazine, souframine, penthazine, dibenzo-1,4-thiazine, phenthiazine, phenosan, dibenzothiazine, feeno, thiodiphenylamine, phenothiazine PubChem CID: 7108 ChEBI: CHEBI:37931 IUPAC-Name: 10H-Phenothiazin SMILES: C1=CC=C2C(=C1)NC3=CC=CC=C3S2

Phenothiazin, 99 %, Thermo Scientific™

Phenothiazin, 99 %, Thermo Scientific™

CAS: 92-84-2 Summenformel: C12H9NS Molekulargewicht (g/mol): 199.28 MDL-Nummer: MFCD00005015 InChI-Schlüssel: WJFKNYWRSNBZNX-UHFFFAOYSA-N Synonym: agrazine, souframine, penthazine, dibenzo-1,4-thiazine, phenthiazine, phenosan, dibenzothiazine, feeno, thiodiphenylamine, phenothiazine PubChem CID: 7108 ChEBI: CHEBI:37931 IUPAC-Name: 10H-Phenothiazin SMILES: C1=CC=C2C(=C1)NC3=CC=CC=C3S2

  spinner