
1,2-Dibrom-3,4,5,6-Tetramethylbenzol, 98 %

1,2-Dibrom-3,4,5,6-Tetramethylbenzol, 98 %

CAS: 36321-73-0 Summenformel: C10H12Br2 Molekulargewicht (g/mol): 292.014 MDL-Nummer: MFCD00154987 InChI-Schlüssel: VEZJOZSIGSNYEB-UHFFFAOYSA-N Synonym: benzene,1,2-dibromo-3,4,5,6-tetramethyl, pubchem21478, benzene, 1,2-dibromo-3,4,5,6-tetramethyl, 1,2-bis bromanyl-3,4,5,6-tetramethyl-benzene PubChem CID: 2752606 IUPAC-Name: 1,2-dibrom-3,4,5,6-tetramethylbenzol SMILES: CC1=C(C(=C(C(=C1C)Br)Br)C)C
