Non Cyclic olefins

Lycopen, >90 %, MP Biomedicals™

Lycopen, >90 %, MP Biomedicals™

CAS: 502-65-8 Summenformel: C40H56 Molekulargewicht (g/mol): 536.888 InChI-Schlüssel: OAIJSZIZWZSQBC-GYZMGTAESA-N Synonym: Lycopin, psi,psi-Carotin, all-trans-Lykopen, trans-Lycopin, Lycopin 7, Lycopin-Van, Lycopin, alltrans, lycopene, all-trans, unii-sb0n2n0wv6, ccris 7925 PubChem CID: 446925 ChEBI: CHEBI:15948 IUPAC-Name: (6E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaen SMILES: CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC=C(C)CCC=C(C)C)C)C)C)C

  spinner