Hydroxy bile acids, alcohols and derivatives

20-Hydroxyecdyson, ≥95 %, MP Biomedicals™

20-Hydroxyecdyson, ≥95 %, MP Biomedicals™

CAS: 5289-74-7 Summenformel: C27H44O7 Molekulargewicht (g/mol): 480.64 MDL-Nummer: MFCD00036740 InChI-Schlüssel: NKDFYOWSKOHCCO-YPVLXUMRSA-N Synonym: crustecdyson, commisterone, Commisteron, Insektenhäutungshormon, Polypodin A, 20-OH-Ecdyson, Crustecdyson, beta-Ekdyson, Ecdysteron, 20-Hydroxyecdyson PubChem CID: 5459840 ChEBI: CHEBI:16587 IUPAC-Name: (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-Trihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-on SMILES: CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C
