
Cortison21-Acetat, 98+ %, Thermo Scientific Chemicals

Cortison21-Acetat, 98+ %, Thermo Scientific Chemicals

CAS: 50-04-4 Summenformel: C23H30O6 Molekulargewicht (g/mol): 402.49 MDL-Nummer: MFCD00003609 InChI-Schlüssel: ITRJWOMZKQRYTA-RFZYENFJSA-N Synonym: adreson, cortisyl, scheroson, cortadren, artriona, biocort acetate, incortin, cortone acetate, cortisone 21-acetate, cortisone acetate PubChem CID: 5745 ChEBI: CHEBI:3897 IUPAC-Name: [2-[(8S,9S,10R,13S,14S,17R)-17-Hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetat SMILES: CC(=O)OCC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3C(=O)C[C@]12C
