
Mifepriston, 98 %, Thermo Scientific™™

Mifepriston, 98 %, Thermo Scientific™™

CAS: 84371-65-3 Summenformel: C29H35NO2 Molekulargewicht (g/mol): 429.59 InChI-Schlüssel: VKHAHZOOUSRJNA-GCNJZUOMSA-N Synonym: mifepristone, mifeprex, mifegyne, mifepriston, corlux, mifepristona, mifepristonum, korlym, mifepristonum latin, mifepristona spanish PubChem CID: 55245 ChEBI: CHEBI:50692 IUPAC-Name: (8S,11R,13S,14S,17S)-11-[4-(Dimethylamino)phenyl]-17-hydroxy-13-methyl-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-on SMILES: CC#CC1(CCC2C1(CC(C3=C4CCC(=O)C=C4CCC23)C5=CC=C(C=C5)N(C)C)C)O

Cyproteronacetat, 98 %, Thermo Scientific™™

Cyproteronacetat, 98 %, Thermo Scientific™™

CAS: 427-51-0 Summenformel: C24H29ClO4 Molekulargewicht (g/mol): 416.94 InChI-Schlüssel: UWFYSQMTEOIJJG-FDTZYFLXSA-N Synonym: cyproterone acetate, androcur, cyproterone 17-o-acetate, cyproteron acetate, cyproteron-r acetate, cyprosterone acetate, unii-4km2bn5jhf, cyproteroneacetate, cyproterone 17alpha-acetate, ccris 4385 PubChem CID: 9880 ChEBI: CHEBI:50743 SMILES: CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)C5CC5C34C)Cl)C)OC(=O)C
