
L-Carnitin, 99+ %

L-Carnitin, 99+ %

CAS: 541-15-1 Summenformel: C7H15NO3 Molekulargewicht (g/mol): 161.201 MDL-Nummer: MFCD00038747 InChI-Schlüssel: PHIQHXFUZVPYII-ZCFIWIBFSA-N Synonym: l-carnitine, levocarnitine, vitamin bt, r-carnitine, carnitor, --carnitine, carnitine, --l-carnitine, karnitin, l---carnitine PubChem CID: 10917 ChEBI: CHEBI:16347 IUPAC-Name: (3R)-3-Hydroxy-4-(trimethylazaniumyl)butanoat SMILES: C[N+](C)(C)CC(CC(=O)[O-])O

L(-)-Carnitin, 99+ %, ACROS Organics™

L(-)-Carnitin, 99+ %, ACROS Organics™

CAS: 541-15-1 Summenformel: C7H15NO3 Molekulargewicht (g/mol): 161.2 MDL-Nummer: MFCD00038747 InChI-Schlüssel: PHIQHXFUZVPYII-ZCFIWIBFSA-N Synonym: l-carnitine, levocarnitine, vitamin bt, r-carnitine, carnitor, --carnitine, carnitine, --l-carnitine, karnitin, l---carnitine PubChem CID: 10917 ChEBI: CHEBI:16347 IUPAC-Name: (3R)-3-Hydroxy-4-(trimethylazaniumyl)butanoat SMILES: C[N+](C)(C)CC(CC(=O)[O-])O
