Carnitines

L(-)-Carnitin, 99+ %, Thermo Scientific™

L(-)-Carnitin, 99+ %, Thermo Scientific™

CAS: 541-15-1 Summenformel: C7H15NO3 Molekulargewicht (g/mol): 161.2 MDL-Nummer: MFCD00038747 InChI-Schlüssel: PHIQHXFUZVPYII-ZCFIWIBFSA-N Synonym: l---carnitine, karnitin, --l-carnitine, carnitine, --carnitine, carnitor, r-carnitine, vitamin bt, levocarnitine, l-carnitine PubChem CID: 10917 ChEBI: CHEBI:16347 IUPAC-Name: (3R)-3-Hydroxy-4-(trimethylazaniumyl)butanoat SMILES: C[N+](C)(C)CC(CC(=O)[O-])O

L-Carnitin, 99+ %, Thermo Scientific™

L-Carnitin, 99+ %, Thermo Scientific™

CAS: 541-15-1 Summenformel: C7H15NO3 Molekulargewicht (g/mol): 161.201 MDL-Nummer: MFCD00038747 InChI-Schlüssel: PHIQHXFUZVPYII-ZCFIWIBFSA-N Synonym: l---carnitine, karnitin, --l-carnitine, carnitine, --carnitine, carnitor, r-carnitine, vitamin bt, levocarnitine, l-carnitine PubChem CID: 10917 ChEBI: CHEBI:16347 IUPAC-Name: (3R)-3-Hydroxy-4-(trimethylazaniumyl)butanoat SMILES: C[N+](C)(C)CC(CC(=O)[O-])O

  spinner