Hexamethonium compounds

Hexamethoniumbromid, 98+ %

Hexamethoniumbromid, 98+ %

CAS: 55-97-0 Summenformel: C12H30Br2N2 Molekulargewicht (g/mol): 362.194 MDL-Nummer: MFCD00011787 InChI-Schlüssel: FAPSXSAPXXJTOU-UHFFFAOYSA-L Synonym: hexamethonium bromide, hexamethonium dibromide, simpatoblock, gangliostat, esametina, hexameton, vegolysen, vegolysin, bistrium bromide, hexonium dibromide PubChem CID: 5938 IUPAC-Name: Trimethyl-[6-(trimethylazaniumyl)hexyl]azanium;dibromid SMILES: C[N+](C)(C)CCCCCC[N+](C)(C)C.[Br-].[Br-]

Hexan-1,6-bis(Tri-n-Butylammonium) Dihydroxid, 20 % w/w wässr. Lsg.

Hexan-1,6-bis(Tri-n-Butylammonium) Dihydroxid, 20 % w/w wässr. Lsg.

CAS: 69762-88-5 Summenformel: C30H68N2O2 Molekulargewicht (g/mol): 488.886 MDL-Nummer: MFCD00216633 InChI-Schlüssel: ALYGOOWRCDZDTJ-UHFFFAOYSA-L Synonym: tributyl-6-tributylazaniumyl hexyl azanium,dihydroxide, n1,n1,n1,n6,n6,n6-hexabutylhexane-1,6-diaminium hydroxide, tributyl 6-tributylammonio hexyl azanium dihydroxide, n,n,n,n,n,n-hexabutylhexamethylenediammonium dihydroxide solution, hexane-1,6-bis tributylammonium dihydroxide w/w aqueous solution, n,n inverted exclamation marka-hexamethylenebis tributylammonium hydroxide, n∼1∼,n∼1∼,n∼1∼,n∼6∼,n∼6∼,n∼6∼-hexabutylhexane-1,6-bis aminium dihydroxide, n,n,n,n inverted exclamation marka,n inverted exclamation marka,n inverted exclamation marka-hexabutylhexamethylenediammonium dihydroxide solution PubChem CID: 15376281 IUPAC-Name: Tributyl-[6-(tributylazaniumyl)hexyl]azanium;dihydroxid SMILES: CCCC[N+](CCCC)(CCCC)CCCCCC[N+](CCCC)(CCCC)CCCC.[OH-].[OH-]
