Nitropyrimidines

5-Nitrohexahydropyrimidin-2,4,6-Trionhydrat, 97 %, Maybridge

5-Nitrohexahydropyrimidin-2,4,6-Trionhydrat, 97 %, Maybridge

CAS: 175278-58-7 Summenformel: C4H5N3O6 Molekulargewicht (g/mol): 191.10 MDL-Nummer: MFCD00160499 InChI-Schlüssel: YKGZAIJTCJOZNK-UHFFFAOYSA-N Synonym: 5-nitropyrimidine-2,4,6 1h,3h,5h-trione xhydrate, 5-nitrohexahydropyrimidine-2,4,6-trione hydrate, 5-nitro-1,3-diazinane-2,4,6-trione hydrate, 5-nitropyrimidine-2,4,6 1h,3h,5h-trione hydrate, 5-nitrobarbituric acid hydrate, c4nh33o5.h2o, 5-nitro-hexahydro-pyrimidine-2,4,6-trione, 2,4,6 1h,3h,5h-pyrimidinetrione,5-nitro-, hydrate 1:1 PubChem CID: 2781274 IUPAC-Name: 5-nitro-1,3-diazinane-2,4,6-trione hydrate SMILES: O.[O-][N+](=O)C1C(=O)NC(=O)NC1=O

  spinner