
Thermo Scientific™ Sulbactam

Thermo Scientific™ Sulbactam

CAS: 68373-14-8 Summenformel: C8H11NO5S Molekulargewicht (g/mol): 233.24 InChI-Schlüssel: FKENQMMABCRJMK-RITPCOANSA-N Synonym: sulbactam, sulbactam acid, penicillanic acid sulfone, sulbactamum, betamaze, 2s,5r-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo 3.2.0 heptane-2-carboxylic acid 4,4-dioxide, penicillanic acid 1,1-dioxide, unii-s4tf6i2330, penicillanic acid dioxide, chembl403 PubChem CID: 130313 ChEBI: CHEBI:9321 IUPAC-Name: (2S,5R)-3,3-Dimethyl-4,4,7-Trioxo-4$l^{6}-Thia-1-Azabicyclo[3.2.0]Heptan-2-Carbonsäure SMILES: CC1(C(N2C(S1(=O)=O)CC2=O)C(=O)O)C
