
Kanamycin-Monosulfat, MP Biomedicals™

Kanamycin-Monosulfat, MP Biomedicals™

CAS: 25389-94-0 Summenformel: C18H38N4O15S Molekulargewicht (g/mol): 582.575 InChI-Schlüssel: OOYGSFOGFJDDHP-IZQIRFRQSA-N Synonym: Kanamycin-Sulfatsalz, Kanamycin A PubChem CID: 134129479 IUPAC-Name: (2R,3S,4S,5S,6R)-2-(Aminomethyl)-6-[(1R,2S,3S,4R,6S)-4,6-Diamino-3-[(2S,3R,4S,5R,6R)-4-Amino-3,5-Dihydroxy-6-(Hydroxymethyl)Oxan-2]Oxy-2-Hydroxycyclohexyl]Oxyoxan-3,4,5-Triol;Schwefelsäure SMILES: C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O

Kanamycin-Sulfat, ACROS Organics™

Kanamycin-Sulfat, ACROS Organics™

CAS: 25389-94-0 Summenformel: C18H38N4O15S Molekulargewicht (g/mol): 582.575 MDL-Nummer: MFCD00070253 InChI-Schlüssel: OOYGSFOGFJDDHP-IZQIRFRQSA-N PubChem CID: 134129479 IUPAC-Name: (2R,3S,4S,5S,6R)-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5R,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxan-3,4,5-triol;Schwefelsäure SMILES: C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O

Amikacin (aus Kanamycin A, weißes kristallines Pulver), Fisher BioReagents

Amikacin (aus Kanamycin A, weißes kristallines Pulver), Fisher BioReagents

CAS: 37517-28-5 Summenformel: C22H43N5O13 Molekulargewicht (g/mol): 585.608 InChI-Schlüssel: LKCWBDHBTVXHDL-RMDFUYIESA-N Synonym: Lukadin PubChem CID: 37768 ChEBI: CHEBI:2637 IUPAC-Name: (2S)-4-amino-N-[(1R,2S,3S,4R,5S)-5-amino-2-[(2S,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2R,3R,4S,5S,6R)-6-(aminomethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-3-hydroxycyclohexyl]-2-hydroxybutanamid SMILES: C1C(C(C(C(C1NC(=O)C(CCN)O)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(C(C(C(O3)CN)O)O)O)N

(-)-Erythromycin, Eur.Pharm., ACROS Organics™

(-)-Erythromycin, Eur.Pharm., ACROS Organics™

CAS: 114-07-8 Summenformel: C37H67NO13 Molekulargewicht (g/mol): 733.94 MDL-Nummer: MFCD00084654 InChI-Schlüssel: ULGZDMOVFRHVEP-RWJQBGPGSA-N PubChem CID: 12560 ChEBI: CHEBI:42355 IUPAC-Name: (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2,10-dion SMILES: CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O

Amphotericin B, 85 %, Acros Organics™

Amphotericin B, 85 %, Acros Organics™

CAS: 1397-89-3 Summenformel: C47H73NO17 Molekulargewicht (g/mol): 924.09 MDL-Nummer: MFCD00877763 InChI-Schlüssel: APKFDSVGJQXUKY-ZNVUZQDLSA-N PubChem CID: 134129663 IUPAC-Name: (1S,3R,18S,19R,20R,21S,25R,27R,30R,31R,33S,35R,37S,38R)-3-[(2R,3R,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy-19,25,27,30,31,33,35,37-octahydroxy-18,20,21-trimethyl-23-oxo-22,39-dioxabicyclo[33.3.1]nonatriaconta-4,6,8,10,12,14,16-heptaen-38-car SMILES: C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C/C=C\C=C/C=C\C=C/C=C\C=C/2)[C@@H](O)[C@@H](N)[C@@H]1O

Tobramycin, 97 %, Acros Organics™

Tobramycin, 97 %, Acros Organics™

CAS: 32986-56-4 Summenformel: C18H37N5O9 Molekulargewicht (g/mol): 467.52 InChI-Schlüssel: NLVFBUXFDBBNBW-PBSUHMDJSA-N PubChem CID: 36294 ChEBI: CHEBI:28864 IUPAC-Name: (2S,3R,4S,5S,6R)-4-amino-2-[(1S,2S,3R,4S,6R)-4,6-diamino-3-[(2R,3R,5S,6R)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxy-2-hydroxycyclohexyl]oxy-6-(hydroxymethyl)oxan-3,5-diol SMILES: C1C(C(C(C(C1N)OC2C(C(C(C(O2)CO)O)N)O)O)OC3C(CC(C(O3)CN)O)N)N

Alfa Aesar™ Amphotericin B, <i>Streptomyces nodosus</i>

Alfa Aesar™ Amphotericin B, Streptomyces nodosus

CAS: 1397-89-3 Summenformel: C47H73NO17 Molekulargewicht (g/mol): 924.09 MDL-Nummer: MFCD00877763 InChI-Schlüssel: APKFDSVGJQXUKY-ZNVUZQDLSA-N PubChem CID: 134129663 IUPAC-Name: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21Z,23Z,25Z,27Z,29Z,31Z,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaen-36-Carbonsäure SMILES: C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C/C=C\C=C/C=C\C=C/C=C\C=C/2)[C@@H](O)[C@@H](N)[C@@H]1O

(-)-Erythromycin, 98 %, ACROS Organics™

(-)-Erythromycin, 98 %, ACROS Organics™

CAS: 114-07-8 Summenformel: C37H67NO13 Molekulargewicht (g/mol): 733.94 MDL-Nummer: MFCD00084654 InChI-Schlüssel: ULGZDMOVFRHVEP-RWJQBGPGSA-N PubChem CID: 12560 ChEBI: CHEBI:42355 IUPAC-Name: (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-{[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy}-14-ethyl-7,12,13-trihydroxy-4-{[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy}-3,5,7,9,11,13-hexamethyl-1-oxacyclotetradecane-2,10-dione SMILES: CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O

Amphotericin B (Gelbe Lösung/250 μg/ml), Fisher BioReagents

Amphotericin B (Gelbe Lösung/250 μg/ml), Fisher BioReagents

CAS: 1397-89-3 Summenformel: C47H73NO17 Molekulargewicht (g/mol): 924.09 MDL-Nummer: MFCD00877763 InChI-Schlüssel: APKFDSVGJQXUKY-ZNVUZQDLSA-N PubChem CID: 134129663 IUPAC-Name: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21Z,23Z,25Z,27Z,29Z,31Z,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylic acid SMILES: C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C/C=C\C=C/C=C\C=C/C=C\C=C/2)[C@@H](O)[C@@H](N)[C@@H]1O

Alfa Aesar™ Kanamycin-Monosulfat, Zellkulturqualität

Alfa Aesar™ Kanamycin-Monosulfat, Zellkulturqualität

CAS: 25389-94-0 Summenformel: C18H38N4O15S Molekulargewicht (g/mol): 582.575 MDL-Nummer: MFCD00070253 InChI-Schlüssel: OOYGSFOGFJDDHP-IZQIRFRQSA-N Synonym: Kanamycin A PubChem CID: 134129479 IUPAC-Name: (2R,3S,4S,5S,6R)-2-(aminomethyl)-6-[(1R,2S,3S,4R,6S)-4,6-diamino-3-[(2S,3R,4S,5R,6R)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-hydroxycyclohexyl]oxyoxan-3,4,5-triol;Schwefelsäure SMILES: C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O

Kanamycinsulfat, UltraPure, Thermo Scientific™

Kanamycinsulfat, UltraPure, Thermo Scientific™

CAS: 25389-94-0 Summenformel: C18H38N4O15S Molekulargewicht (g/mol): 582.575 MDL-Nummer: MFCD00070253 InChI-Schlüssel: OOYGSFOGFJDDHP-IZQIRFRQSA-N Synonym: Kanamycin A PubChem CID: 134129479 IUPAC-Name: (2R,3S,4S,5S,6R)-2-(Aminomethyl)-6-[(1R,2S,3S,4R,6S)-4,6-Diamino-3-[(2S,3R,4S,5R,6R)-4-Amino-3,5-Dihydroxy-6-(Hydroxymethyl)Oxan-2-yl]oxy-2-Hydroxycyclohexyl]Oxyoxan-3,4,5-Triol;Schwefelsäure SMILES: C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O

Alfa Aesar™ Erythromycin, Zellkulturqualität

Alfa Aesar™ Erythromycin, Zellkulturqualität

CAS: 114-07-8 Summenformel: C37H67NO13 Molekulargewicht (g/mol): 733.94 MDL-Nummer: MFCD00084654 InChI-Schlüssel: ULGZDMOVFRHVEP-RWJQBGPGSA-N PubChem CID: 12560 ChEBI: CHEBI:42355 IUPAC-Name: (3R,4S,5S,6R,7R,9R,11R,12R,13S,14R)-6-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-14-ethyl-7,12,13-trihydroxy-4-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2,10-dion SMILES: CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C)(O)C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@]1(C)O

Alfa Aesar™ Tylosin Tartrat, 95 %

Alfa Aesar™ Tylosin Tartrat, 95 %

CAS: 1405-54-5 Summenformel: C50H83NO23 Molekulargewicht (g/mol): 1066.198 MDL-Nummer: MFCD00070094 InChI-Schlüssel: ICVKYYINQHWDLM-HYHSIFHGSA-N Synonym: Pharmasin; [R-(R'R')]-2,3-Dihydroxybutanedionate Tylosin salt PubChem CID: 131673832 IUPAC-Name: (2R,3R)-2,3-dihydroxybutanidsäure;2-[(4R,5S,6S,7R,9R,15R,16R)-6-[(2R,3R,4R,5S,6R)-5-[(2S,4R,5S,6S)-4,5-dihydroxy-4,6-dimethyloxan-2-yl]oxy-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-15-[[(2R,3R,4R,5R,6R)-5-hydroxy-3,4-dimetho SMILES: CCC1C(C=C(C=CC(=O)C(CC(C(C(C(CC(=O)O1)O)C)OC2C(C(C(C(O2)C)OC3CC(C(C(O3)C)O)(C)O)N(C)C)O)CC=O)C)C)COC4C(C(C(C(O4)C)O)OC)OC.C(C(C(=O)O)O)(C(=O)O)O

Amphotericin B, Antibiotika-Lösung, MP Biomedicals

Amphotericin B, Antibiotika-Lösung, MP Biomedicals

CAS: 1397-89-3 Summenformel: C47H73NO17 Molekulargewicht (g/mol): 924.09 MDL-Nummer: MFCD00877763 InChI-Schlüssel: APKFDSVGJQXUKY-ZNVUZQDLSA-N Synonym: Fungizone PubChem CID: 134129663 IUPAC-Name: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21Z,23Z,25Z,27Z,29Z,31Z,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaen-36-Carbonsäure SMILES: C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C/C=C\C=C/C=C\C=C/C=C\C=C/2)[C@@H](O)[C@@H](N)[C@@H]1O

Amphotericin B, MP Biomedicals

Amphotericin B, MP Biomedicals

CAS: 1397-89-3 Summenformel: C47H73NO17 Molekulargewicht (g/mol): 924.09 MDL-Nummer: MFCD00877763 InChI-Schlüssel: APKFDSVGJQXUKY-ZNVUZQDLSA-N Synonym: Amphotericin B, Fungizone, Amphotericine B PubChem CID: 134129663 IUPAC-Name: (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19Z,21Z,23Z,25Z,27Z,29Z,31Z,33R,35S,36R,37S)-33-{[(2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyloxan-2-yl]oxy}-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaen-36-Carbonsäure SMILES: C[C@H]1O[C@@H](O[C@@H]2C[C@@H]3O[C@@](O)(C[C@H](O)[C@H]3C(O)=O)C[C@@H](O)C[C@@H](O)[C@H](O)CC[C@@H](O)C[C@@H](O)CC(=O)O[C@@H](C)[C@H](C)[C@H](O)[C@@H](C)\C=C/C=C\C=C/C=C\C=C/C=C\C=C/2)[C@@H](O)[C@@H](N)[C@@H]1O
