Ellagic acids and derivatives

Ellaginsäurehydrat, 97 %, kann bis zu 12 % Wasser betragen

Ellaginsäurehydrat, 97 %, kann bis zu 12 % Wasser betragen

CAS: 476-66-4 Summenformel: C14H6O8 Molekulargewicht (g/mol): 302.194 MDL-Nummer: MFCD00149494 InChI-Schlüssel: AFSDNFLWKVMVRB-UHFFFAOYSA-N Synonym: ellagic acid, benzoaric acid, lagistase, eleagic acid, alizarine yellow, elagostasine, 2,3,7,8-tetrahydroxychromeno 5,4,3-cde chromene-5,10-dione, ellagic acid dihydrate, llagic acid, acide ellagique PubChem CID: 5281855 ChEBI: CHEBI:4775 SMILES: C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)O

  spinner