
Phenanthrenchinon, 95 %, ACROS Organics™

Phenanthrenchinon, 95 %, ACROS Organics™

CAS: 84-11-7 Summenformel: C14H8O2 Molekulargewicht (g/mol): 208.22 MDL-Nummer: MFCD00001163 InChI-Schlüssel: YYVYAPXYZVYDHN-UHFFFAOYSA-N Synonym: 9,10-phenanthrenequinone, phenanthrenequinone, 9,10-phenanthrenedione, 9,10-phenanthraquinone, phenanthraquinone, 9,10-phenanthroquinone, 9-10 phenanthrene quinone, unii-42l7bz8h74, ccris 7615, phenanthrene, 9,10-dihydro-9,10-dioxo PubChem CID: 6763 ChEBI: CHEBI:37454 IUPAC-Name: Phenanthren-9,10-dion SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O

Alfa Aesar™ 9,10-Phenanthrenchinon, 95 %

Alfa Aesar™ 9,10-Phenanthrenchinon, 95 %

CAS: 84-11-7 Summenformel: C14H8O2 Molekulargewicht (g/mol): 208.216 MDL-Nummer: MFCD00001163 InChI-Schlüssel: YYVYAPXYZVYDHN-UHFFFAOYSA-N Synonym: 9,10-phenanthrenequinone, phenanthrenequinone, 9,10-phenanthrenedione, 9,10-phenanthraquinone, phenanthraquinone, 9,10-phenanthroquinone, 9-10 phenanthrene quinone, unii-42l7bz8h74, ccris 7615, phenanthrene, 9,10-dihydro-9,10-dioxo PubChem CID: 6763 ChEBI: CHEBI:37454 IUPAC-Name: Phenanthren-9,10-dion SMILES: C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O
