Pyrimidine 2',3'-dideoxyribonucleosides

3'-Azido-3'-Desoxythymidin, 98 %, Acros Organics ™

3'-Azido-3'-Desoxythymidin, 98 %, Acros Organics ™

CAS: 30516-87-1 Summenformel: C10H13N5O4 Molekulargewicht (g/mol): 267.25 MDL-Nummer: MFCD00006536 InChI-Schlüssel: HBOMLICNUCNMMY-XLPZGREQSA-N Synonym: azt; azidothymidine; zdv; zidovudine, 1-2r-4-azido-5-hydroxymethyl oxolan-2-yl-5-methyl-3h-pyrimidine-2,4-dione PubChem CID: 455007 IUPAC-Name: 1-[(2R,5S)-4-Azido-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidin-2,4-dion SMILES: CC1=CN([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO)O2)C(=O)NC1=O

2',3'-Dideoxycytidin, 98 %, Acros Organics

2',3'-Dideoxycytidin, 98 %, Acros Organics

CAS: 7481-89-2 Summenformel: C9H13N3O3 Molekulargewicht (g/mol): 211.22 InChI-Schlüssel: WREGKURFCTUGRC-POYBYMJQSA-N Synonym: zalcitabine, 2',3'-dideoxycytidine, dideoxycytidine, ddcyd, hivid, ddc, cytidine, 2',3'-dideoxy, zalcitibine, ddc antiviral, 4-amino-1-2r,5s-5-hydroxymethyl tetrahydrofuran-2-yl pyrimidin-2 1h-one PubChem CID: 24066 ChEBI: CHEBI:10101 IUPAC-Name: 4-Amino-1-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-on SMILES: C1CC(OC1CO)N2C=CC(=NC2=O)N

  spinner