Organic dichromates

Pyridiniumdichromat, 98 %, Thermo Scientific™

Pyridiniumdichromat, 98 %, Thermo Scientific™

CAS: 20039-37-6 Summenformel: C10H12Cr2N2O7 Molekulargewicht (g/mol): 376.205 MDL-Nummer: MFCD00013105 InChI-Schlüssel: LMYWWPCAXXPJFF-UHFFFAOYSA-P Synonym: acmc-209f5g, pyridiniumdichromate pdc, bis pyridium chromate, dipyridinium dichromate, pyridinium-dichromate, pyridiniumdichromate, oxido-oxido dioxo chromio oxy-dioxochromium; pyridin-1-ium, pyridinium dichromate pdc, cornforth reagent, pyridinium dichromate PubChem CID: 2724130 IUPAC-Name: Oxido-(Oxido(dioxo)chromio)oxy-Dioxochrom;pyridin-1-ium SMILES: C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1.[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-]

Pyridiniumdichromat, 98 %, Thermo Scientific™™

Pyridiniumdichromat, 98 %, Thermo Scientific™™

CAS: 20039-37-6 Summenformel: C10H12Cr2N2O7 Molekulargewicht (g/mol): 376.2 InChI-Schlüssel: LMYWWPCAXXPJFF-UHFFFAOYSA-P Synonym: acmc-209f5g, pyridiniumdichromate pdc, bis pyridium chromate, dipyridinium dichromate, pyridinium-dichromate, pyridiniumdichromate, oxido-oxido dioxo chromio oxy-dioxochromium; pyridin-1-ium, pyridinium dichromate pdc, cornforth reagent, pyridinium dichromate PubChem CID: 2724130 IUPAC-Name: Oxido-(Oxido(dioxo)chromio)oxy-Dioxochrom;pyridin-1-ium SMILES: C1=CC=[NH+]C=C1.C1=CC=[NH+]C=C1.[O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-]

  spinner