Organic pyrophosphates

Alfa Aesar™ Tetrabenzylpyrophosphat, 98 %

Alfa Aesar™ Tetrabenzylpyrophosphat, 98 %

CAS: 990-91-0 Summenformel: C28H28O7P2 Molekulargewicht (g/mol): 538.473 MDL-Nummer: MFCD00051941 InChI-Schlüssel: NSBNXCZCLRBQTA-UHFFFAOYSA-N Synonym: tetrabenzyl pyrophosphate, tetrabenzyl diphosphate, pyrophosphoric acid tetrabenzyl ester, tetrabenzylpyrophosphate, diphosphoric acid, tetrakis phenylmethyl ester, dibenzyl dibenzyloxyphosphoryl oxyphosphonate, benzyl pyrophosphate, acmc-209sbp, tetra benzyl pyrophosphate, tetrabenzyl diphosphate # PubChem CID: 563183 IUPAC-Name: Dibenzyl-Bs(phenylmethoxy)phosphorylphosphat SMILES: C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4
