
Thermo Scientific™ Bilirubin, 99 %

Thermo Scientific™ Bilirubin, 99 %

CAS: 635-65-4 Summenformel: C33H36N4O6 Molekulargewicht (g/mol): 584.673 MDL-Nummer: MFCD00005499 InChI-Schlüssel: BPYKTIZUTYGOLE-IFADSCNNSA-N Synonym: biline-8,12-dipropionic acid, 1,10,19,22,23,24-hexahydro-2,7,13,17-tetramethyl-1,19-dioxo-3,18-divinyl, rfm9x3lj49, 21h-biline-8,12-dipropanoic acid, 2,17-diethenyl-1,10,19,22,23,24-hexahydro-3,7,13,18-tetramethyl-1,19-dioxo, bilirubin ixalpha, unii-rfm9x3lj49, principal bile pigment, bilirubin ix-alpha, hemetoidin, hematoidin, bilirubin PubChem CID: 5280352 ChEBI: CHEBI:16990 IUPAC-Name: 3-[2-[[3-(2-Carboxyethyl)-5-[(Z)-(3-Ethenyl-4-Methyl-5-Oxopyrrol-2-yliden)Methyl]-4-Methyl-1H-Pyrrol-2-yl]Methyl]-5-[(Z)-(4-Ethenyl-3-Methyl-5-Oxopyrrol-2-yliden)Methyl]-4-Methyl-1H-Pyrrol-3-yl]Propansäure SMILES: CC1=C(NC(=C1CCC(=O)O)CC2=C(C(=C(N2)C=C3C(=C(C(=O)N3)C)C=C)C)CCC(=O)O)C=C4C(=C(C(=O)N4)C=C)C
