Peroxybenzoic acids and derivatives

Alfa Aesar™ tert-Butyl peroxybenzoat, 98 %

Alfa Aesar™ tert-Butyl peroxybenzoat, 98 %

CAS: 614-45-9 Summenformel: C11H14O3 Molekulargewicht (g/mol): 194.23 MDL-Nummer: MFCD00008802 InChI-Schlüssel: GJBRNHKUVLOCEB-UHFFFAOYSA-N Synonym: tert-butyl peroxybenzoate, tert-butyl perbenzoate, t-butyl perbenzoate, chaloxyd tbpb, perbutyl z, esperox 10, novox, trigonox c, tert-butyl peroxy benzoate, terc.butylperbenzoan PubChem CID: 11966 IUPAC-Name: tert-Butylbenzolcarboperoxoat SMILES: CC(C)(C)OOC(=O)C1=CC=CC=C1

tert-Butylperoxybenzoat, 98 %, ACROS Organics™

tert-Butylperoxybenzoat, 98 %, ACROS Organics™

CAS: 614-45-9 Summenformel: C11H14O3 Molekulargewicht (g/mol): 194.23 MDL-Nummer: MFCD00008802 InChI-Schlüssel: GJBRNHKUVLOCEB-UHFFFAOYSA-N Synonym: tert-butyl peroxybenzoate, tert-butyl perbenzoate, t-butyl perbenzoate, chaloxyd tbpb, perbutyl z, esperox 10, novox, trigonox c, tert-butyl peroxy benzoate, terc.butylperbenzoan PubChem CID: 11966 IUPAC-Name: tert-Butylbenzolcarboperoxoat SMILES: CC(C)(C)OOC(=O)C1=CC=CC=C1
