
Thermo Scientific™ Aztreonam

Thermo Scientific™ Aztreonam

CAS: 78110-38-0 Summenformel: C13H17N5O8S2 Molekulargewicht (g/mol): 435.426 InChI-Schlüssel: WZPBZJONDBGPKJ-PSGLRMFWSA-N PubChem CID: 56842327 IUPAC-Name: 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-methyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-Methylpropansäure SMILES: CC1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=NOC(C)(C)C(=O)O)C2=CSC(=N2)N

4-Acetoxy-2-azetidinon, 97 %, Thermo Scientific™™

4-Acetoxy-2-azetidinon, 97 %, Thermo Scientific™™

CAS: 28562-53-0 Summenformel: C5H7NO3 Molekulargewicht (g/mol): 129.12 MDL-Nummer: MFCD00010593 InChI-Schlüssel: OEYMQQDJCUHKQS-UHFFFAOYNA-N Synonym: 4-acetoxy-2-azetidinone, 2-azetidinone, 4-acetyloxy, 4-acetoxyazetidinone, 4-oxoazetidin-2-yl acetate, 2-oxoazetidinium 4-acetate, 2-azetidinone, 4-acetyloxy-, 4r, 4-acetoxy-azetidinone, acmc-20bsq9, 4-acetoxyazetidin-2-one, 4-acetoxyazetidine-2-one PubChem CID: 119981 IUPAC-Name: 4-Oxoazetidin-2-ylacetat SMILES: CC(=O)OC1CC(=O)N1

Aztreonam, 95.7 %, MP Biomedicals™

Aztreonam, 95.7 %, MP Biomedicals™

CAS: 78110-38-0 Summenformel: C13H17N5O8S2 Molekulargewicht (g/mol): 435.426 InChI-Schlüssel: WZPBZJONDBGPKJ-PSGLRMFWSA-N Synonym: Azthreonam, Azactam PubChem CID: 56842327 IUPAC-Name: 2-[(E)-[1-(2-Amino-1,3-Thiazol-4-yl)-2-[[(2R,3R)-2-Methyl-4-Oxo-1-Sulfoazetidin-3-yl]Amino]-2-Oxoethylidin]Aminoxy-2-Methylpropansäure SMILES: CC1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=NOC(C)(C)C(=O)O)C2=CSC(=N2)N
