Monobactams

Thermo Scientific™ Aztreonam

Thermo Scientific™ Aztreonam

CAS: 78110-38-0 Summenformel: C13H17N5O8S2 Molekulargewicht (g/mol): 435.426 InChI-Schlüssel: WZPBZJONDBGPKJ-PSGLRMFWSA-N PubChem CID: 56842327 IUPAC-Name: 2-[(E)-[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2R,3R)-2-methyl-4-oxo-1-sulfoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-Methylpropansäure SMILES: CC1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=NOC(C)(C)C(=O)O)C2=CSC(=N2)N

Aztreonam, 95.7 %, MP Biomedicals™

Aztreonam, 95.7 %, MP Biomedicals™

CAS: 78110-38-0 Summenformel: C13H17N5O8S2 Molekulargewicht (g/mol): 435.426 InChI-Schlüssel: WZPBZJONDBGPKJ-PSGLRMFWSA-N Synonym: Azactam, Azthreonam PubChem CID: 56842327 IUPAC-Name: 2-[(E)-[1-(2-Amino-1,3-Thiazol-4-yl)-2-[[(2R,3R)-2-Methyl-4-Oxo-1-Sulfoazetidin-3-yl]Amino]-2-Oxoethylidin]Aminoxy-2-Methylpropansäure SMILES: CC1C(C(=O)N1S(=O)(=O)O)NC(=O)C(=NOC(C)(C)C(=O)O)C2=CSC(=N2)N

  spinner