2-sulfobenzoic acids

Alfa Aesar™ 2-Sulfobenzoesäure-Hydrat, 98 %

Alfa Aesar™ 2-Sulfobenzoesäure-Hydrat, 98 %

CAS: 123333-68-6 Summenformel: C7H8O6S Molekulargewicht (g/mol): 220.195 MDL-Nummer: MFCD00149534 InChI-Schlüssel: HVJWSZOEEIYKSS-UHFFFAOYSA-N Synonym: 2-sulfobenzoic acid hydrate, benzoic acid, 2-sulfo-hydrate, acmc-20anmu, 2-sulphobenzoic acid hydrate, c7h6o5s.h2o, 2-sulfobenzoic acid, oxamethane, benzoic acid, 2-sulfo-, monohydrate PubChem CID: 24820382 IUPAC-Name: 2-sulfobenzoesäure;hydrat SMILES: C1=CC=C(C(=C1)C(=O)O)S(=O)(=O)O.O

  spinner