Sulfoxide
- (3)
- (2)
- (2)
- (3)
- (3)
- (1)
- (3)
- (3)
- (1)
- (2)
- (3)
- (1)
- (1)
- (1)
- (5)
- (1)
- (1)
- (2)
- (2)
- (1)
- (2)
- (1)
- (5)
- (3)
- (8)
Gefilterte Suchergebnisse
Dimethylsulfoxid, TRC
Hochreine organische Moleküle und analytische Standards, strategisch weltweit geliefert, um Innovation und wirtschaftlichen Erfolg zu ermöglichen.
| Chemischer Name oder Material | Dimethylsulfoxide |
|---|---|
| IUPAC-Name | Methylsulfinylmethan |
| CAS | 67-68-5 |
| Empfohlene Lagerung | +20 °C |
| Molekulargewicht (g/mol) | 78.13 |
| SMILES | CS(=O)C |
| Synonym | Dimethyl sulfoxide,Sulfinylbismethane,Methylsulfinylmethane,Methane, sulfinylbis- (9CI),Methyl sulfoxide (8CI),DMS 70,DMS 90,DMSO,DMSO Evol,Demasorb,Demavet,Demeso,Demsodrox,Dimethyl sulfoxide,Dimethyl sulphoxide,Dimethylsulfoxide,Dimexide,Dimexidum,Dipirartril-tropico,Dolicur,Domoso,Dromisol,Durasorb,Gamasol 90,Herpid,Hyadur,Infiltrina,Kemsol,NSC 763,Rimso 50,SQ 9453,Sclerosol,Somipront,Sulfinylbismethane,Syntexan,Methane, 1,1'-sulfinylbis- |
| InChI-Formel | InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 |
| Summenformel | C2 H6 O S |
| Formelmasse | 78.0139 |
Iberin, TRC
CAS: 505-44-2 Summenformel: C5 H9 N O S2 Molekulargewicht (g/mol): 163.26 Synonym: 1-Isothiocyanato-3-(methylsulfinyl)-propane,3-Methylsulfinylpropyl Isothiocyanate,NSC 321801; IUPAC-Name: 1-isothiocyanato-3-methylsulfinylpropane SMILES: CS(=O)CCCN=C=S
| IUPAC-Name | 1-isothiocyanato-3-methylsulfinylpropane |
|---|---|
| CAS | 505-44-2 |
| Molekulargewicht (g/mol) | 163.26 |
| SMILES | CS(=O)CCCN=C=S |
| Synonym | 1-Isothiocyanato-3-(methylsulfinyl)-propane,3-Methylsulfinylpropyl Isothiocyanate,NSC 321801; |
| Summenformel | C5 H9 N O S2 |
2,2'-Sulfinyldiethanol, TRC
CAS: 3085-45-8 Summenformel: C4 H10 O3 S Molekulargewicht (g/mol): 138.19 Synonym: 2,2'-Sulfinyldiethanol,Beta,beta'-Dihydroxydiethyl sulphoxide,ethanol, 2,2'sulfinylbis- IUPAC-Name: 2-(2-hydroxyethylsulfinyl)ethanol SMILES: OCCS(=O)CCO
| IUPAC-Name | 2-(2-hydroxyethylsulfinyl)ethanol |
|---|---|
| CAS | 3085-45-8 |
| Molekulargewicht (g/mol) | 138.19 |
| SMILES | OCCS(=O)CCO |
| Synonym | 2,2'-Sulfinyldiethanol,Beta,beta'-Dihydroxydiethyl sulphoxide,ethanol, 2,2'sulfinylbis- |
| Summenformel | C4 H10 O3 S |
Perphenazine Sulfoxide, TRC
CAS: 10078-25-8 Summenformel: C21 H26 Cl N3 O2 S Molekulargewicht (g/mol): 419.97 Synonym: 2-[4-[3-(2-Chloro-5-oxido-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol,Perphenazine Imp. A (EP),Perphenazine Sulphoxide IUPAC-Name: 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol SMILES: OCCN1CCN(CCCN2c3ccccc3S(=O)c4ccc(Cl)cc24)CC1
| IUPAC-Name | 2-[4-[3-(2-chloro-5-oxophenothiazin-10-yl)propyl]piperazin-1-yl]ethanol |
|---|---|
| CAS | 10078-25-8 |
| Molekulargewicht (g/mol) | 419.97 |
| SMILES | OCCN1CCN(CCCN2c3ccccc3S(=O)c4ccc(Cl)cc24)CC1 |
| Synonym | 2-[4-[3-(2-Chloro-5-oxido-10H-phenothiazin-10-yl)propyl]piperazin-1-yl]ethanol,Perphenazine Imp. A (EP),Perphenazine Sulphoxide |
| Summenformel | C21 H26 Cl N3 O2 S |
Phorate Oxon Sulfoxide, TRC
CAS: 2588-05-8 Summenformel: C7 H17 O4 P S2 Molekulargewicht (g/mol): 260.31 Synonym: Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate IUPAC-Name: 1-[ethoxy(ethylsulfinylmethylsulfanyl)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)SCS(=O)CC
| IUPAC-Name | 1-[ethoxy(ethylsulfinylmethylsulfanyl)phosphoryl]oxyethane |
|---|---|
| CAS | 2588-05-8 |
| Molekulargewicht (g/mol) | 260.31 |
| SMILES | CCOP(=O)(OCC)SCS(=O)CC |
| Synonym | Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate |
| Summenformel | C7 H17 O4 P S2 |
Demeton-S Sulfoxide, TRC
CAS: 2496-92-6 Summenformel: C8 H19 O4 P S2 Molekulargewicht (g/mol): 274.34 Synonym: Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide IUPAC-Name: 1-diethoxyphosphorylsulfanyl-2-ethylsulfinylethane SMILES: CCOP(=O)(OCC)SCCS(=O)CC
| IUPAC-Name | 1-diethoxyphosphorylsulfanyl-2-ethylsulfinylethane |
|---|---|
| CAS | 2496-92-6 |
| Molekulargewicht (g/mol) | 274.34 |
| SMILES | CCOP(=O)(OCC)SCCS(=O)CC |
| Synonym | Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide |
| Summenformel | C8 H19 O4 P S2 |
6-Methylsulfinylhexyl Isothiocyanate, TRC
CAS: 4430-35-7 Summenformel: C8 H15 N O S2 Molekulargewicht (g/mol): 205.34 Synonym: Isothiocyanic Acid 6-(Methylsulfinyl)hexyl Ester,1-Isothiocyanato-6-(methylsulfinyl)hexane,Hesperin IUPAC-Name: 1-isothiocyanato-6-methylsulfinyl-hexane SMILES: CS(=O)CCCCCCN=C=S
| IUPAC-Name | 1-isothiocyanato-6-methylsulfinyl-hexane |
|---|---|
| CAS | 4430-35-7 |
| Molekulargewicht (g/mol) | 205.34 |
| SMILES | CS(=O)CCCCCCN=C=S |
| Synonym | Isothiocyanic Acid 6-(Methylsulfinyl)hexyl Ester,1-Isothiocyanato-6-(methylsulfinyl)hexane,Hesperin |
| Summenformel | C8 H15 N O S2 |
(R)-4-(Methylsulfinyl)-1-butylamine, TRC
CAS: 84104-30-3 Summenformel: C5H13NOS Molekulargewicht (g/mol): 135.23 Synonym: (R)-4-(Methylsulfinyl)butylamine SMILES: CS(=O)CCCCN
| CAS | 84104-30-3 |
|---|---|
| Molekulargewicht (g/mol) | 135.23 |
| SMILES | CS(=O)CCCCN |
| Synonym | (R)-4-(Methylsulfinyl)butylamine |
| Summenformel | C5H13NOS |
S-Methyl-N,N-diethylthiocarbamate Sulfoxide, TRC
CAS: 140703-15-7 Summenformel: C6 H13 N O2 S Molekulargewicht (g/mol): 163.24 Synonym: Disulfiram Impurity 4 IUPAC-Name: N,N-diethyl-1-methylsulfinylformamide SMILES: CCN(CC)C(=O)S(=O)C
| IUPAC-Name | N,N-diethyl-1-methylsulfinylformamide |
|---|---|
| CAS | 140703-15-7 |
| Molekulargewicht (g/mol) | 163.24 |
| SMILES | CCN(CC)C(=O)S(=O)C |
| Synonym | Disulfiram Impurity 4 |
| Summenformel | C6 H13 N O2 S |