Imidazoquinolines

Imiquimod, 99 %

Imiquimod, 99 %

CAS: 99011-02-6 Summenformel: C14H16N4 Molekulargewicht (g/mol): 240.31 MDL-Nummer: MFCD00866946 InChI-Schlüssel: DOUYETYNHWVLEO-UHFFFAOYSA-N Synonym: imiquimod, aldara, zyclara, beselna, 1-2-methylpropyl-1h-imidazo 4,5-c quinolin-4-amine, zartra, imiquimod acetate, 1-isobutyl-1h-imidazo 4,5-c quinolin-4-amine, 4-amino-1-isobutyl-1h-imidazo 4,5-c quinoline PubChem CID: 57469 ChEBI: CHEBI:36704 IUPAC-Name: 1-(2-Methylpropyl)imidazo[4,5-c]quinolin-4-amin SMILES: CC(C)CN1C=NC2=C1C1=CC=CC=C1N=C2N

  spinner