Hydroxyquinolones

2,4-Dihydroxychinolin, 97 %

2,4-Dihydroxychinolin, 97 %

CAS: 86-95-3 Summenformel: C9H7NO2 Molekulargewicht (g/mol): 161.16 MDL-Nummer: MFCD00006744 InChI-Schlüssel: HDHQZCHIXUUSMK-UHFFFAOYSA-N Synonym: 2,4-quinolinediol, 2,4-dihydroxyquinoline, 4-hydroxyquinolin-2 1h-one, quinoline-2,4-diol, 4-hydroxy-2-quinolone, 4-hydroxycarbostyril, 2 1h-quinolinone, 4-hydroxy, 4-hydroxy-2-quinolinone, hydroxycarbostyril, 2-hydroxyquinolin-4 1h-one PubChem CID: 54680871 ChEBI: CHEBI:75926 IUPAC-Name: 4-Hydroxy-1H-Chinolin-2-on SMILES: C1=CC=C2C(=C1)C(=CC(=O)N2)O

  spinner