Sugar amino acids and derivatives

N-Acetylneuraminsäure, 99 %, ACROS Organics™

N-Acetylneuraminsäure, 99 %, ACROS Organics™

CAS: 131-48-6 Summenformel: C11H19NO9 Molekulargewicht (g/mol): 309.271 MDL-Nummer: MFCD00006620 InChI-Schlüssel: SQVRNKJHWKZAKO-LFIUDZTESA-N Synonym: n-acetylneuramic acid, spectrum_000450, spectrum2_000559, spectrum4_000432, spectrum5_001326, spectrum2300147, 2s,4s,5s,6s-5-acetamido-2,4-dihydroxy-6-2r-1,2,3-trihydroxypropyl oxane-2-carboxylic acid PubChem CID: 126963458 IUPAC-Name: (4S,5S,6R)-5-Acetamido-2,4-Dihydroxy-6-[(1R,2r)-1,2,3-Trihydroxypropyl]oxan-2-Carbonsäure SMILES: CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)O)O

cis-3-Azabicyclo[3.1.0]Hexan-2-Carbonsäure, 95 %, ACROS Organics™

cis-3-Azabicyclo[3.1.0]Hexan-2-Carbonsäure, 95 %, ACROS Organics™

CAS: 22255-16-9 Summenformel: C6H9NO2 Molekulargewicht (g/mol): 127.14 MDL-Nummer: MFCD03093875,MFCD05663832 InChI-Schlüssel: JBDOTWVUXVXVDR-UOWFLXDJSA-N Synonym: 3-azabicyclo 3.1.0 hexane-2-carboxylicacid, 1s,2s,5r PubChem CID: 77906410 IUPAC-Name: (1R,2R,5S)-3-Azabicyclo[3.1.0]hexan-3-ium-2-carboxylat SMILES: [O-]C(=O)[C@@H]1[NH2+]C[C@H]2C[C@@H]12

Alfa Aesar™ N-(-)-Acetylneuraminsäure, 97 %

Alfa Aesar™ N-(-)-Acetylneuraminsäure, 97 %

CAS: 131-48-6 Summenformel: C11H19NO9 Molekulargewicht (g/mol): 309.271 MDL-Nummer: MFCD00006620 InChI-Schlüssel: SQVRNKJHWKZAKO-LFIUDZTESA-N Synonym: n-acetylneuramic acid, spectrum_000450, spectrum2_000559, spectrum4_000432, spectrum5_001326, spectrum2300147, 2s,4s,5s,6s-5-acetamido-2,4-dihydroxy-6-2r-1,2,3-trihydroxypropyl oxane-2-carboxylic acid PubChem CID: 126963458 IUPAC-Name: (4S,5S,6R)-5-Acetamido-2,4-Dihydroxy-6-[(1R,2r)-1,2,3-Trihydroxypropyl]oxan-2-Carbonsäure SMILES: CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)O)O

  spinner