Benzol und substituierte Derivate
Gefilterte Suchergebnisse
Benzylalkohol, 99 %, rein, Thermo Scientific Chemicals
CAS: 100-51-6 Summenformel: C7H8O Molekulargewicht (g/mol): 108.14 MDL-Nummer: MFCD00004599,MFCD03792087 InChI-Schlüssel: WVDDGKGOMKODPV-UHFFFAOYSA-N Synonym: benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol PubChem CID: 244 ChEBI: CHEBI:17987 IUPAC-Name: Phenylmethanol SMILES: OCC1=CC=CC=C1
| InChI-Schlüssel | WVDDGKGOMKODPV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Phenylmethanol |
| PubChem CID | 244 |
| CAS | 100-51-6 |
| ChEBI | CHEBI:17987 |
| MDL-Nummer | MFCD00004599,MFCD03792087 |
| Molekulargewicht (g/mol) | 108.14 |
| SMILES | OCC1=CC=CC=C1 |
| Synonym | benzyl alcohol,benzenemethanol,phenylcarbinol,benzoyl alcohol,hydroxytoluene,benzenecarbinol,phenylmethyl alcohol,alpha-toluenol,hydroxymethyl benzene,benzylalcohol |
| Summenformel | C7H8O |
p-Anisaldehyd +99 %, Thermo Scientific Chemicals
CAS: 123-11-5 Summenformel: C8H8O2 Molekulargewicht (g/mol): 136.15 MDL-Nummer: MFCD00003385 InChI-Schlüssel: ZRSNZINYAWTAHE-UHFFFAOYSA-N Synonym: p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine PubChem CID: 31244 ChEBI: CHEBI:28235 IUPAC-Name: 4-Methoxybenzaldehyd SMILES: COC1=CC=C(C=C1)C=O
| InChI-Schlüssel | ZRSNZINYAWTAHE-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Methoxybenzaldehyd |
| PubChem CID | 31244 |
| CAS | 123-11-5 |
| ChEBI | CHEBI:28235 |
| MDL-Nummer | MFCD00003385 |
| Molekulargewicht (g/mol) | 136.15 |
| SMILES | COC1=CC=C(C=C1)C=O |
| Synonym | p-anisaldehyde,anisaldehyde,anisic aldehyde,p-methoxybenzaldehyde,4-anisaldehyde,aubepine,p-anisic aldehyde,p-formylanisole,benzaldehyde, 4-methoxy,crategine |
| Summenformel | C8H8O2 |
Natriumsalicylat, 99 %, Thermo Scientific Chemicals
CAS: 54-21-7 Summenformel: C7H5NaO3 Molekulargewicht (g/mol): 160.104 MDL-Nummer: MFCD00002440 InChI-Schlüssel: ABBQHOQBGMUPJH-UHFFFAOYSA-M Synonym: sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl PubChem CID: 16760658 ChEBI: CHEBI:9180 IUPAC-Name: Natrium;2-Hydroxybenzoat SMILES: C1=CC=C(C(=C1)C(=O)[O-])O.[Na+]
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ABBQHOQBGMUPJH-UHFFFAOYSA-M |
|---|---|
| IUPAC-Name | Natrium;2-Hydroxybenzoat |
| PubChem CID | 16760658 |
| CAS | 54-21-7 |
| ChEBI | CHEBI:9180 |
| MDL-Nummer | MFCD00002440 |
| Molekulargewicht (g/mol) | 160.104 |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])O.[Na+] |
| Synonym | sodium salicylate,sodium 2-hydroxybenzoate,salsonin,clin,enterosalicyl,enterosalil,entrosalyl,glutosalyl,kerasalicyl,magsalyl |
| Summenformel | C7H5NaO3 |
4-Aminobenzoesäure, 99 %, Thermo Scientific Chemicals
CAS: 150-13-0 Summenformel: C7H7NO2 Molekulargewicht (g/mol): 137.14 MDL-Nummer: MFCD00007894 InChI-Schlüssel: ALYNCZNDIQEVRV-UHFFFAOYSA-N Synonym: p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino PubChem CID: 978 ChEBI: CHEBI:30753 IUPAC-Name: 4-Aminobenzoesäure SMILES: NC1=CC=C(C=C1)C(O)=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 4-Aminobenzoesäure |
| PubChem CID | 978 |
| CAS | 150-13-0 |
| ChEBI | CHEBI:30753 |
| MDL-Nummer | MFCD00007894 |
| Molekulargewicht (g/mol) | 137.14 |
| SMILES | NC1=CC=C(C=C1)C(O)=O |
| Synonym | p-aminobenzoic acid,paba,para-aminobenzoic acid,vitamin bx,sunbrella,p-carboxyaniline,4-carboxyaniline,hachemina,paraminol,benzoic acid, 4-amino |
| Summenformel | C7H7NO2 |
Benzoesäure, 99 %, reinst, Thermo Scientific Chemicals
CAS: 65-85-0 Summenformel: C7H6O2 Molekulargewicht (g/mol): 122.12 MDL-Nummer: MFCD00002398 InChI-Schlüssel: WPYMKLBDIGXBTP-UHFFFAOYSA-N Synonym: benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv PubChem CID: 243 ChEBI: CHEBI:30746 IUPAC-Name: Benzoesäure SMILES: C1=CC=C(C=C1)C(=O)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | WPYMKLBDIGXBTP-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Benzoesäure |
| PubChem CID | 243 |
| CAS | 65-85-0 |
| ChEBI | CHEBI:30746 |
| MDL-Nummer | MFCD00002398 |
| Molekulargewicht (g/mol) | 122.12 |
| SMILES | C1=CC=C(C=C1)C(=O)O |
| Synonym | benzenecarboxylic acid,dracylic acid,benzeneformic acid,carboxybenzene,phenylformic acid,benzenemethanoic acid,phenylcarboxylic acid,retardex,benzoesaeure gk,benzoesaeure gv |
| Summenformel | C7H6O2 |
Methylsalicylat, 98 %, Thermo Scientific Chemicals
CAS: 119-36-8 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.149 MDL-Nummer: MFCD00002214 InChI-Schlüssel: OSWPMRLSEDHDFF-UHFFFAOYSA-N Synonym: methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester PubChem CID: 4133 ChEBI: CHEBI:31832 IUPAC-Name: Methyl 2-Hydroxybenzoat SMILES: COC(=O)C1=CC=CC=C1O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | OSWPMRLSEDHDFF-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 2-Hydroxybenzoat |
| PubChem CID | 4133 |
| CAS | 119-36-8 |
| ChEBI | CHEBI:31832 |
| MDL-Nummer | MFCD00002214 |
| Molekulargewicht (g/mol) | 152.149 |
| SMILES | COC(=O)C1=CC=CC=C1O |
| Synonym | methyl salicylate,wintergreen oil,gaultheria oil,betula oil,teaberry oil,sweet birch oil,oil of wintergreen,analgit,spicewood oil,2-hydroxybenzoic acid methyl ester |
| Summenformel | C8H8O3 |
Triphenylphosphin, 99 %, Thermo Scientific Chemicals
CAS: 603-35-0 Summenformel: C18H15P Molekulargewicht (g/mol): 262.29 MDL-Nummer: MFCD00003043 MFCD20489348 InChI-Schlüssel: RIOQSEWOXXDEQQ-UHFFFAOYSA-N Synonym: triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin PubChem CID: 11776 IUPAC-Name: Triphenylphosphan SMILES: C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Triphenylphosphan |
| PubChem CID | 11776 |
| CAS | 603-35-0 |
| MDL-Nummer | MFCD00003043 MFCD20489348 |
| Molekulargewicht (g/mol) | 262.29 |
| SMILES | C1=CC=C(C=C1)P(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylphosphine,triphenyl phosphine,phosphine, triphenyl,triphenylphosphorus,triphenyl-phosphane,triphenylphosphide,phosphorustriphenyl,trifenylfosfin,trifenylfosfin czech,triphenylphosphine resin |
| Summenformel | C18H15P |
Ethyl 4-hydroxybenzoat, 99 %, Thermo Scientific Chemicals
CAS: 120-47-8 Summenformel: C9H10O3 Molekulargewicht (g/mol): 166.18 MDL-Nummer: MFCD00002353 InChI-Schlüssel: NUVBSKCKDOMJSU-UHFFFAOYSA-N Synonym: ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e PubChem CID: 8434 ChEBI: CHEBI:86616 IUPAC-Name: Ethyl 4-Hydroxybenzoat SMILES: CCOC(=O)C1=CC=C(C=C1)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | NUVBSKCKDOMJSU-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Ethyl 4-Hydroxybenzoat |
| PubChem CID | 8434 |
| CAS | 120-47-8 |
| ChEBI | CHEBI:86616 |
| MDL-Nummer | MFCD00002353 |
| Molekulargewicht (g/mol) | 166.18 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O |
| Synonym | ethylparaben,ethyl paraben,ethyl p-hydroxybenzoate,mycocten,ethyl parasept,4-hydroxybenzoic acid ethyl ester,easeptol,ethyl butex,ethyl parahydroxybenzoate,tegosept e |
| Summenformel | C9H10O3 |
Methyl 4-Hydroxybenzoat 99 %, Thermo Scientific Chemicals
CAS: 99-76-3 Summenformel: C8H8O3 Molekulargewicht (g/mol): 152.149 MDL-Nummer: MFCD00002352 InChI-Schlüssel: LXCFILQKKLGQFO-UHFFFAOYSA-N Synonym: methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m PubChem CID: 7456 ChEBI: CHEBI:31835 IUPAC-Name: Methyl 4-Hydroxybenzoat SMILES: COC(=O)C1=CC=C(C=C1)O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | LXCFILQKKLGQFO-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Methyl 4-Hydroxybenzoat |
| PubChem CID | 7456 |
| CAS | 99-76-3 |
| ChEBI | CHEBI:31835 |
| MDL-Nummer | MFCD00002352 |
| Molekulargewicht (g/mol) | 152.149 |
| SMILES | COC(=O)C1=CC=C(C=C1)O |
| Synonym | methylparaben,methyl paraben,methyl p-hydroxybenzoate,nipagin,methyl parahydroxybenzoate,maseptol,p-hydroxybenzoic acid methyl ester,4-hydroxybenzoic acid methyl ester,p-carbomethoxyphenol,tegosept m |
| Summenformel | C8H8O3 |
Methylendi-p-phenyl diisocyanat, 98 %, Flocken, Thermo Scientific Chemicals
CAS: 101-68-8 Summenformel: C15H10N2O2 Molekulargewicht (g/mol): 250.26 MDL-Nummer: MFCD00036131 InChI-Schlüssel: UPMLOUAZCHDJJD-UHFFFAOYSA-N Synonym: 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate PubChem CID: 7570 ChEBI: CHEBI:53218 IUPAC-Name: 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol SMILES: C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | UPMLOUAZCHDJJD-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | 1-Isocyanat-4-[(4-isocyanatphenyl)methyl]Benzol |
| PubChem CID | 7570 |
| CAS | 101-68-8 |
| ChEBI | CHEBI:53218 |
| MDL-Nummer | MFCD00036131 |
| Molekulargewicht (g/mol) | 250.26 |
| SMILES | C1=CC(=CC=C1CC2=CC=C(C=C2)N=C=O)N=C=O |
| Synonym | 4,4'-diphenylmethane diisocyanate,diphenylmethane diisocyanate,isonate,4,4'-diisocyanatodiphenylmethane,p,p'-diphenylmethane diisocyanate,bis 4-isocyanatophenyl methane,4,4'-methylenebis phenyl isocyanate,methylbisphenyl isocyanate,1,1'-methylenebis 4-isocyanatobenzene,methylene diphenyl diisocyanate |
| Summenformel | C15H10N2O2 |
Benzophenon, 99 %, rein, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.22 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| Molekulargewicht (g/mol) | 182.22 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
Benzophenon, 99 %, Thermo Scientific Chemicals
CAS: 119-61-9 Summenformel: C13H10O Molekulargewicht (g/mol): 182.222 MDL-Nummer: MFCD00003076 InChI-Schlüssel: RWCCWEUUXYIKHB-UHFFFAOYSA-N Synonym: benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone PubChem CID: 3102 ChEBI: CHEBI:41308 IUPAC-Name: Diphenylmethanon SMILES: C1=CC=C(C=C1)C(=O)C2=CC=CC=C2
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | RWCCWEUUXYIKHB-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diphenylmethanon |
| PubChem CID | 3102 |
| CAS | 119-61-9 |
| ChEBI | CHEBI:41308 |
| MDL-Nummer | MFCD00003076 |
| Molekulargewicht (g/mol) | 182.222 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
| Synonym | benzophenone,diphenyl ketone,benzoylbenzene,phenyl ketone,methanone, diphenyl,alpha-oxoditane,ketone, diphenyl,benzene, benzoyl,alpha-oxodiphenylmethane,diphenylketone |
| Summenformel | C13H10O |
Di-n-Octylphthalat, 98 %, Thermo Scientific Chemicals
CAS: 117-84-0 Summenformel: C24H38O4 Molekulargewicht (g/mol): 390.564 MDL-Nummer: MFCD00015292 InChI-Schlüssel: MQIUGAXCHLFZKX-UHFFFAOYSA-N Synonym: dioctyl phthalate,di-n-octyl phthalate,dinopol nop,n-octyl phthalate,vinicizer 85,phthalic acid, dioctyl ester,polycizer 162,dnop,phthalic acid di-n-octyl ester,dioctyl 1,2-benzenedicarboxylate PubChem CID: 8346 ChEBI: CHEBI:34679 IUPAC-Name: Dioctyl-Benzol-1,2-Dicarboxylat SMILES: CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | MQIUGAXCHLFZKX-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Dioctyl-Benzol-1,2-Dicarboxylat |
| PubChem CID | 8346 |
| CAS | 117-84-0 |
| ChEBI | CHEBI:34679 |
| MDL-Nummer | MFCD00015292 |
| Molekulargewicht (g/mol) | 390.564 |
| SMILES | CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC |
| Synonym | dioctyl phthalate,di-n-octyl phthalate,dinopol nop,n-octyl phthalate,vinicizer 85,phthalic acid, dioctyl ester,polycizer 162,dnop,phthalic acid di-n-octyl ester,dioctyl 1,2-benzenedicarboxylate |
| Summenformel | C24H38O4 |
DAPT, Thermo Scientific Chemicals
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
Diethylphthalat, 99 %, Thermo Scientific Chemicals
CAS: 84-66-2 Summenformel: C12H14O4 Molekulargewicht (g/mol): 222.24 MDL-Nummer: MFCD00009111 InChI-Schlüssel: FLKPEMZONWLCSK-UHFFFAOYSA-N Synonym: diethyl phthalate,phthalic acid diethyl ester,ethyl phthalate,anozol,neantine,phthalol,solvanol,diethyl o-phthalate,palatinol a,placidol e PubChem CID: 6781 ChEBI: CHEBI:34698 IUPAC-Name: Diethylbenzol-1,2-Dicarboxylat SMILES: CCOC(=O)C1=CC=CC=C1C(=O)OCC
Versand am Tag der Bestellung für Produkte, die vor 14 Uhr bestellt wurden. Versand am nächsten Arbeitstag bei Bestellung nach 14 Uhr.
Erfahren Sie mehr
| InChI-Schlüssel | FLKPEMZONWLCSK-UHFFFAOYSA-N |
|---|---|
| IUPAC-Name | Diethylbenzol-1,2-Dicarboxylat |
| PubChem CID | 6781 |
| CAS | 84-66-2 |
| ChEBI | CHEBI:34698 |
| MDL-Nummer | MFCD00009111 |
| Molekulargewicht (g/mol) | 222.24 |
| SMILES | CCOC(=O)C1=CC=CC=C1C(=O)OCC |
| Synonym | diethyl phthalate,phthalic acid diethyl ester,ethyl phthalate,anozol,neantine,phthalol,solvanol,diethyl o-phthalate,palatinol a,placidol e |
| Summenformel | C12H14O4 |