Cyclic peptides

Polymyxin B-Sulfat MP Biomedicals

Polymyxin B-Sulfat MP Biomedicals

CAS: 1405-20-5 Summenformel: C56H100N16O17S Molekulargewicht (g/mol): 1301.571 MDL-Nummer: MFCD00131991 InChI-Schlüssel: HFMDLUQUEXNBOP-ZFUOWTTOSA-N Synonym: Aerosporin PubChem CID: 133109994 IUPAC-Name: N-[(2 S)-4-amino-1-[[(2S,3R)-1-[[(2S)-4-amino-1-oxo-1-[[(3S,6,18R)-6,9,18-tris(2-aminoethyl)-15-benzyl-3-[(1R)-1-hydroxyethyl]-12-(2-methylpropyl)-2,5,8,11,14,17,20-heptaoxo-1,4,7,10,13,16,19-heptazacyclotricos-21-yl]amino]butan-2-yl]amino]-3-hydroxy-1-ox SMILES: CCC(C)CCCCC(=O)NC(CCN)C(=O)NC(C(C)O)C(=O)NC(CCN)C(=O)NC1CCNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC1=O)CCN)CC2=CC=CC=C2)CC(C)C)CCN)CCN)C(C)O.OS(=O)(=O)O
