4-sulfobenzoic acids

4-Sulfobenzoesäure-Monokaliumsalz, 95 %, Thermo Scientific™

4-Sulfobenzoesäure-Monokaliumsalz, 95 %, Thermo Scientific™

CAS: 5399-63-3 Summenformel: C7H5KO5S Molekulargewicht (g/mol): 240.27 MDL-Nummer: MFCD00007509 InChI-Schlüssel: PXRJBUPXKDXDLG-UHFFFAOYSA-M Synonym: benzoic acid, 4-sulfo-, monopotassium salt, 4-sulfobenzoic acid monopotassium salt, 4-sulphobenzoic acid monopotassium salt, 4-sulfobenzoicacidmonopotassiumsalt, potassium hydrogen 4-sulphonatobenzoate, p-sulphobenzoic acid, monopotassium salt, potassium 4-sulphobenzoate, benzoic acid, 4-sulfo-, potassium salt 1:1, potassium 4-sulfobenzoate, p-potassiooxysulfonyl benzoic acid PubChem CID: 23670833 IUPAC-Name: Kalium;4-sulfobenzoat SMILES: C1=CC(=CC=C1C(=O)[O-])S(=O)(=O)O.[K+]
